C19H20ClNO5 — CID 2521191
N-(1,3-benzodioxol-5-yl)-3-chloro-5-ethoxy-4-propoxybenzamide (PubChem CID 2521191) has the molecular formula C19H20ClNO5 and a molecular weight of 377.82 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-3-chloro-5-ethoxy-4-propoxybenzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-3-chloro-5-ethoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 2521191 |
| Molecular Formula | C19H20ClNO5 |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-3-chloro-5-ethoxy-4-propoxybenzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)Nc2ccc3c(c2)OCO3)cc1OCC |
| InChI | InChI=1S/C19H20ClNO5/c1-3-7-24-18-14(20)8-12(9-17(18)23-4-2)19(22)21-13-5-6-15-16(10-13)26-11-25-15/h5-6,8-10H,3-4,7,11H2,1-2H3,(H,21,22) |
| InChIKey | UCAQHDYILMOCNP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |