C21H25ClN2O4S — CID 56529828
S-[4-[(3-chloro-5-ethoxy-4-propoxybenzoyl)amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56529828) has the molecular formula C21H25ClN2O4S and a molecular weight of 436.96 g/mol. Its IUPAC name is S-[4-[(3-chloro-5-ethoxy-4-propoxybenzoyl)amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[(3-chloro-5-ethoxy-4-propoxybenzoyl)amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56529828 |
| Molecular Formula | C21H25ClN2O4S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | S-[4-[(3-chloro-5-ethoxy-4-propoxybenzoyl)amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CCCOc1c(Cl)cc(C(=O)Nc2ccc(SC(=O)N(C)C)cc2)cc1OCC |
| InChI | InChI=1S/C21H25ClN2O4S/c1-5-11-28-19-17(22)12-14(13-18(19)27-6-2)20(25)23-15-7-9-16(10-8-15)29-21(26)24(3)4/h7-10,12-13H,5-6,11H2,1-4H3,(H,23,25) |
| InChIKey | IUMMBJURBCZQRZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|