C21H26ClN3O3 — CID 55483903
3-chloro-5-ethoxy-4-propoxy-N-(6-pyrrolidin-1-yl-3-pyridinyl)benzamide (PubChem CID 55483903) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is 3-chloro-5-ethoxy-4-propoxy-N-(6-pyrrolidin-1-yl-3-pyridinyl)benzamide.
| Compound Name | 3-chloro-5-ethoxy-4-propoxy-N-(6-pyrrolidin-1-yl-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 55483903 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3-chloro-5-ethoxy-4-propoxy-N-(6-pyrrolidin-1-yl-3-pyridinyl)benzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)Nc2ccc(N3CCCC3)nc2)cc1OCC |
| InChI | InChI=1S/C21H26ClN3O3/c1-3-11-28-20-17(22)12-15(13-18(20)27-4-2)21(26)24-16-7-8-19(23-14-16)25-9-5-6-10-25/h7-8,12-14H,3-6,9-11H2,1-2H3,(H,24,26) |
| InChIKey | UXUINZVWJUJCPE-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |