C25H35ClN4O3 — CID 55744394
4-butoxy-3-chloro-5-ethoxy-N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]benzamide (PubChem CID 55744394) has the molecular formula C25H35ClN4O3 and a molecular weight of 475.03 g/mol. Its IUPAC name is 4-butoxy-3-chloro-5-ethoxy-N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]benzamide.
| Compound Name | 4-butoxy-3-chloro-5-ethoxy-N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 55744394 |
| Molecular Formula | C25H35ClN4O3 |
| Molecular Weight | 475.03 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 4-butoxy-3-chloro-5-ethoxy-N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]benzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)NCc2ccc(N3CCN(CC)CC3)nc2)cc1OCC |
| InChI | InChI=1S/C25H35ClN4O3/c1-4-7-14-33-24-21(26)15-20(16-22(24)32-6-3)25(31)28-18-19-8-9-23(27-17-19)30-12-10-29(5-2)11-13-30/h8-9,15-17H,4-7,10-14,18H2,1-3H3,(H,28,31) |
| InChIKey | AACLAERTHHITPR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.03 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|