C19H33N5O2 — CID 86870917
1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(5-methoxypentyl)urea (PubChem CID 86870917) has the molecular formula C19H33N5O2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(5-methoxypentyl)urea.
| Compound Name | 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(5-methoxypentyl)urea |
|---|---|
| PubChem CID | 86870917 |
| Molecular Formula | C19H33N5O2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 1-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-3-(5-methoxypentyl)urea |
| SMILES | CCN1CCN(c2ccc(CNC(=O)NCCCCCOC)cn2)CC1 |
| InChI | InChI=1S/C19H33N5O2/c1-3-23-10-12-24(13-11-23)18-8-7-17(15-21-18)16-22-19(25)20-9-5-4-6-14-26-2/h7-8,15H,3-6,9-14,16H2,1-2H3,(H2,20,22,25) |
| InChIKey | KMEOAMSOKXRUAK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|