C21H20ClNO5 — CID 52688828
3-chloro-5-ethoxy-N-(2-oxochromen-6-yl)-4-propoxybenzamide (PubChem CID 52688828) has the molecular formula C21H20ClNO5 and a molecular weight of 401.85 g/mol. Its IUPAC name is 3-chloro-5-ethoxy-N-(2-oxochromen-6-yl)-4-propoxybenzamide.
| Compound Name | 3-chloro-5-ethoxy-N-(2-oxochromen-6-yl)-4-propoxybenzamide |
|---|---|
| PubChem CID | 52688828 |
| Molecular Formula | C21H20ClNO5 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 3-chloro-5-ethoxy-N-(2-oxochromen-6-yl)-4-propoxybenzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)Nc2ccc3oc(=O)ccc3c2)cc1OCC |
| InChI | InChI=1S/C21H20ClNO5/c1-3-9-27-20-16(22)11-14(12-18(20)26-4-2)21(25)23-15-6-7-17-13(10-15)5-8-19(24)28-17/h5-8,10-12H,3-4,9H2,1-2H3,(H,23,25) |
| InChIKey | RHRJVQCRKATIOR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|