C26H23NO6 — CID 55978677
3-ethoxy-N-(2-oxochromen-6-yl)-4-(2-phenoxyethoxy)benzamide (PubChem CID 55978677) has the molecular formula C26H23NO6 and a molecular weight of 445.47 g/mol. Its IUPAC name is 3-ethoxy-N-(2-oxochromen-6-yl)-4-(2-phenoxyethoxy)benzamide.
| Compound Name | 3-ethoxy-N-(2-oxochromen-6-yl)-4-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 55978677 |
| Molecular Formula | C26H23NO6 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 3-ethoxy-N-(2-oxochromen-6-yl)-4-(2-phenoxyethoxy)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc3oc(=O)ccc3c2)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C26H23NO6/c1-2-30-24-17-19(8-11-23(24)32-15-14-31-21-6-4-3-5-7-21)26(29)27-20-10-12-22-18(16-20)9-13-25(28)33-22/h3-13,16-17H,2,14-15H2,1H3,(H,27,29) |
| InChIKey | ICGCCMXRWYEPPR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|