C20H39N3O3Si — CID 166591610
tert-butyl N-[(3R)-1-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-pyrazol-3-yl]pentan-3-yl]carbamate (PubChem CID 166591610) has the molecular formula C20H39N3O3Si and a molecular weight of 397.64 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-pyrazol-3-yl]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-pyrazol-3-yl]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 166591610 |
| Molecular Formula | C20H39N3O3Si |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | tert-butyl N-[(3R)-1-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-1H-pyrazol-3-yl]pentan-3-yl]carbamate |
| SMILES | CC[C@H](CCc1cc(CO[Si](C)(C)C(C)(C)C)[nH]n1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H39N3O3Si/c1-10-15(21-18(24)26-19(2,3)4)11-12-16-13-17(23-22-16)14-25-27(8,9)20(5,6)7/h13,15H,10-12,14H2,1-9H3,(H,21,24)(H,22,23)/t15-/m1/s1 |
| InChIKey | IDQAKPBPIBHTMZ-OAHLLOKOSA-N |
| XLogP | 5.17 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|