C19H30N2O5 — CID 58242160
tert-butyl N-[(3R)-1-[4-formamido-2-(2-hydroxyethoxy)phenyl]pentan-3-yl]carbamate (PubChem CID 58242160) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[4-formamido-2-(2-hydroxyethoxy)phenyl]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[4-formamido-2-(2-hydroxyethoxy)phenyl]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 58242160 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | tert-butyl N-[(3R)-1-[4-formamido-2-(2-hydroxyethoxy)phenyl]pentan-3-yl]carbamate |
| SMILES | CC[C@H](CCc1ccc(NC=O)cc1OCCO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H30N2O5/c1-5-15(21-18(24)26-19(2,3)4)8-6-14-7-9-16(20-13-23)12-17(14)25-11-10-22/h7,9,12-13,15,22H,5-6,8,10-11H2,1-4H3,(H,20,23)(H,21,24)/t15-/m1/s1 |
| InChIKey | DIVBYPBWGRPYAD-OAHLLOKOSA-N |
| XLogP | 2.86 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|