C25H42N2O4 — CID 10788974
tert-butyl N-[1-(5-decyl-2-formamidophenyl)-3-hydroxypropan-2-yl]carbamate (PubChem CID 10788974) has the molecular formula C25H42N2O4 and a molecular weight of 434.62 g/mol. Its IUPAC name is tert-butyl N-[1-(5-decyl-2-formamidophenyl)-3-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(5-decyl-2-formamidophenyl)-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10788974 |
| Molecular Formula | C25H42N2O4 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | tert-butyl N-[1-(5-decyl-2-formamidophenyl)-3-hydroxypropan-2-yl]carbamate |
| SMILES | CCCCCCCCCCc1ccc(NC=O)c(CC(CO)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C25H42N2O4/c1-5-6-7-8-9-10-11-12-13-20-14-15-23(26-19-29)21(16-20)17-22(18-28)27-24(30)31-25(2,3)4/h14-16,19,22,28H,5-13,17-18H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | QKSDUVPDFXMVIG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|