C24H39NO3 — CID 87838060
tert-butyl N-[1-(4-octylphenyl)-5-oxopentan-3-yl]carbamate (PubChem CID 87838060) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is tert-butyl N-[1-(4-octylphenyl)-5-oxopentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-octylphenyl)-5-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 87838060 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | tert-butyl N-[1-(4-octylphenyl)-5-oxopentan-3-yl]carbamate |
| SMILES | CCCCCCCCc1ccc(CCC(CC=O)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H39NO3/c1-5-6-7-8-9-10-11-20-12-14-21(15-13-20)16-17-22(18-19-26)25-23(27)28-24(2,3)4/h12-15,19,22H,5-11,16-18H2,1-4H3,(H,25,27) |
| InChIKey | YZIKMSYFHUHARV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|