C37H58N2O5 — CID 10531804
benzyl (2S)-2-[4-decyl-2-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-methylanilino]-3-methylbutanoate (PubChem CID 10531804) has the molecular formula C37H58N2O5 and a molecular weight of 610.88 g/mol. Its IUPAC name is benzyl (2S)-2-[4-decyl-2-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-methylanilino]-3-methylbutanoate.
| Compound Name | benzyl (2S)-2-[4-decyl-2-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-methylanilino]-3-methylbutanoate |
|---|---|
| PubChem CID | 10531804 |
| Molecular Formula | C37H58N2O5 |
| Molecular Weight | 610.88 g/mol |
| Exact Mass | 610.43 |
| IUPAC Name | benzyl (2S)-2-[4-decyl-2-[3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]-N-methylanilino]-3-methylbutanoate |
| SMILES | CCCCCCCCCCc1ccc(N(C)[C@H](C(=O)OCc2ccccc2)C(C)C)c(CC(CO)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C37H58N2O5/c1-8-9-10-11-12-13-14-16-19-29-22-23-33(31(24-29)25-32(26-40)38-36(42)44-37(4,5)6)39(7)34(28(2)3)35(41)43-27-30-20-17-15-18-21-30/h15,17-18,20-24,28,32,34,40H,8-14,16,19,25-27H2,1-7H3,(H,38,42)/t32?,34-/m0/s1 |
| InChIKey | KDQAEIHOCVPGEI-DDKACPBQSA-N |
| XLogP | 8.00 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.88 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|