C19H24F3NO4 — CID 58242175
tert-butyl N-[(3R)-1-[2-(2-hydroxyethoxy)-6-(trifluoromethyl)phenyl]pent-1-yn-3-yl]carbamate (PubChem CID 58242175) has the molecular formula C19H24F3NO4 and a molecular weight of 387.40 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[2-(2-hydroxyethoxy)-6-(trifluoromethyl)phenyl]pent-1-yn-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[2-(2-hydroxyethoxy)-6-(trifluoromethyl)phenyl]pent-1-yn-3-yl]carbamate |
|---|---|
| PubChem CID | 58242175 |
| Molecular Formula | C19H24F3NO4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | tert-butyl N-[(3R)-1-[2-(2-hydroxyethoxy)-6-(trifluoromethyl)phenyl]pent-1-yn-3-yl]carbamate |
| SMILES | CC[C@H](C#Cc1c(OCCO)cccc1C(F)(F)F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24F3NO4/c1-5-13(23-17(25)27-18(2,3)4)9-10-14-15(19(20,21)22)7-6-8-16(14)26-12-11-24/h6-8,13,24H,5,11-12H2,1-4H3,(H,23,25)/t13-/m1/s1 |
| InChIKey | GOVCJGDHMJHXIB-CYBMUJFWSA-N |
| XLogP | 3.73 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|