C21H27N3O5 — CID 168831893
tert-butyl N-[4-oxo-3-phenylmethoxy-2-(propan-2-ylcarbamoyl)-1-pyridinyl]carbamate (PubChem CID 168831893) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-3-phenylmethoxy-2-(propan-2-ylcarbamoyl)-1-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-3-phenylmethoxy-2-(propan-2-ylcarbamoyl)-1-pyridinyl]carbamate |
|---|---|
| PubChem CID | 168831893 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | tert-butyl N-[4-oxo-3-phenylmethoxy-2-(propan-2-ylcarbamoyl)-1-pyridinyl]carbamate |
| SMILES | CC(C)NC(=O)c1c(OCc2ccccc2)c(=O)ccn1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H27N3O5/c1-14(2)22-19(26)17-18(28-13-15-9-7-6-8-10-15)16(25)11-12-24(17)23-20(27)29-21(3,4)5/h6-12,14H,13H2,1-5H3,(H,22,26)(H,23,27) |
| InChIKey | PCOIZZJAIWMPRN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |