C24H33N3O8 — CID 163999089
tert-butyl N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethylcarbamoyl]-4-oxo-3-phenylmethoxy-1-pyridinyl]carbamate (PubChem CID 163999089) has the molecular formula C24H33N3O8 and a molecular weight of 491.54 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethylcarbamoyl]-4-oxo-3-phenylmethoxy-1-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethylcarbamoyl]-4-oxo-3-phenylmethoxy-1-pyridinyl]carbamate |
|---|---|
| PubChem CID | 163999089 |
| Molecular Formula | C24H33N3O8 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethylcarbamoyl]-4-oxo-3-phenylmethoxy-1-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nn1ccc(=O)c(OCc2ccccc2)c1C(=O)NCCOCCOCCO |
| InChI | InChI=1S/C24H33N3O8/c1-24(2,3)35-23(31)26-27-11-9-19(29)21(34-17-18-7-5-4-6-8-18)20(27)22(30)25-10-13-32-15-16-33-14-12-28/h4-9,11,28H,10,12-17H2,1-3H3,(H,25,30)(H,26,31) |
| InChIKey | UHISUUWGMISTMV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|