C22H31N3O6 — CID 134484200
1-amino-N-[2-(2-butoxy-2-methoxyethoxy)ethyl]-4-oxo-3-phenylmethoxypyridine-2-carboxamide (PubChem CID 134484200) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is 1-amino-N-[2-(2-butoxy-2-methoxyethoxy)ethyl]-4-oxo-3-phenylmethoxypyridine-2-carboxamide.
| Compound Name | 1-amino-N-[2-(2-butoxy-2-methoxyethoxy)ethyl]-4-oxo-3-phenylmethoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 134484200 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 1-amino-N-[2-(2-butoxy-2-methoxyethoxy)ethyl]-4-oxo-3-phenylmethoxypyridine-2-carboxamide |
| SMILES | CCCCOC(COCCNC(=O)c1c(OCc2ccccc2)c(=O)ccn1N)OC |
| InChI | InChI=1S/C22H31N3O6/c1-3-4-13-30-19(28-2)16-29-14-11-24-22(27)20-21(18(26)10-12-25(20)23)31-15-17-8-6-5-7-9-17/h5-10,12,19H,3-4,11,13-16,23H2,1-2H3,(H,24,27) |
| InChIKey | KRPPHPDNDQGQJR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|