C19H25N3O5 — CID 70369313
1-amino-N-(4,4-dimethoxybutyl)-4-oxo-3-phenylmethoxypyridine-2-carboxamide (PubChem CID 70369313) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is 1-amino-N-(4,4-dimethoxybutyl)-4-oxo-3-phenylmethoxypyridine-2-carboxamide.
| Compound Name | 1-amino-N-(4,4-dimethoxybutyl)-4-oxo-3-phenylmethoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 70369313 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-amino-N-(4,4-dimethoxybutyl)-4-oxo-3-phenylmethoxypyridine-2-carboxamide |
| SMILES | COC(CCCNC(=O)c1c(OCc2ccccc2)c(=O)ccn1N)OC |
| InChI | InChI=1S/C19H25N3O5/c1-25-16(26-2)9-6-11-21-19(24)17-18(15(23)10-12-22(17)20)27-13-14-7-4-3-5-8-14/h3-5,7-8,10,12,16H,6,9,11,13,20H2,1-2H3,(H,21,24) |
| InChIKey | GAMYEKKDTAZVNQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|