C18H22N2O4 — CID 143761971
1-(2-hydroxyethyl)-4-oxo-3-phenylmethoxy-N-propylpyridine-2-carboxamide (PubChem CID 143761971) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-4-oxo-3-phenylmethoxy-N-propylpyridine-2-carboxamide.
| Compound Name | 1-(2-hydroxyethyl)-4-oxo-3-phenylmethoxy-N-propylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 143761971 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-(2-hydroxyethyl)-4-oxo-3-phenylmethoxy-N-propylpyridine-2-carboxamide |
| SMILES | CCCNC(=O)c1c(OCc2ccccc2)c(=O)ccn1CCO |
| InChI | InChI=1S/C18H22N2O4/c1-2-9-19-18(23)16-17(15(22)8-10-20(16)11-12-21)24-13-14-6-4-3-5-7-14/h3-8,10,21H,2,9,11-13H2,1H3,(H,19,23) |
| InChIKey | XXJDSCOPPQFVPJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |