C26H37N3O8 — CID 155298269
(5,5-dimethoxypentylamino)methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-3-phenylmethoxypyridine-2-carboxylate (PubChem CID 155298269) has the molecular formula C26H37N3O8 and a molecular weight of 519.60 g/mol. Its IUPAC name is (5,5-dimethoxypentylamino)methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-3-phenylmethoxypyridine-2-carboxylate.
| Compound Name | (5,5-dimethoxypentylamino)methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-3-phenylmethoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 155298269 |
| Molecular Formula | C26H37N3O8 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | (5,5-dimethoxypentylamino)methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-3-phenylmethoxypyridine-2-carboxylate |
| SMILES | COC(CCCCNCOC(=O)c1c(OCc2ccccc2)c(=O)ccn1NC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C26H37N3O8/c1-26(2,3)37-25(32)28-29-16-14-20(30)23(35-17-19-11-7-6-8-12-19)22(29)24(31)36-18-27-15-10-9-13-21(33-4)34-5/h6-8,11-12,14,16,21,27H,9-10,13,15,17-18H2,1-5H3,(H,28,32) |
| InChIKey | GCNKUHKNDUGCKC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|