C29H37N3O7S2 — CID 129302795
tert-butyl N-[2-[2-[2-[[2-phenylmethoxy-3-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)benzoyl]amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 129302795) has the molecular formula C29H37N3O7S2 and a molecular weight of 603.76 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[[2-phenylmethoxy-3-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)benzoyl]amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[[2-phenylmethoxy-3-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)benzoyl]amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 129302795 |
| Molecular Formula | C29H37N3O7S2 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.21 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[[2-phenylmethoxy-3-(2-sulfanylidene-1,3-thiazolidine-3-carbonyl)benzoyl]amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC(=O)c1cccc(C(=O)N2CCSC2=S)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H37N3O7S2/c1-29(2,3)39-27(35)31-13-16-37-18-17-36-15-12-30-25(33)22-10-7-11-23(26(34)32-14-19-41-28(32)40)24(22)38-20-21-8-5-4-6-9-21/h4-11H,12-20H2,1-3H3,(H,30,33)(H,31,35) |
| InChIKey | YJFUGDFIADPOFI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|