C11H11ClN4O2 — CID 166414959
2-chloro-N-[4-(1H-1,2,4-triazol-5-ylmethoxy)phenyl]acetamide (PubChem CID 166414959) has the molecular formula C11H11ClN4O2 and a molecular weight of 266.69 g/mol. Its IUPAC name is 2-chloro-N-[4-(1H-1,2,4-triazol-5-ylmethoxy)phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-(1H-1,2,4-triazol-5-ylmethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 166414959 |
| Molecular Formula | C11H11ClN4O2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-chloro-N-[4-(1H-1,2,4-triazol-5-ylmethoxy)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(OCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C11H11ClN4O2/c12-5-11(17)15-8-1-3-9(4-2-8)18-6-10-13-7-14-16-10/h1-4,7H,5-6H2,(H,15,17)(H,13,14,16) |
| InChIKey | MPYCPSGBGZAQQB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|