C17H18BrN5O2S — CID 12951577
2-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethylamino]-5-phenylmethoxy-1H-pyrimidin-6-one (PubChem CID 12951577) has the molecular formula C17H18BrN5O2S and a molecular weight of 436.34 g/mol. Its IUPAC name is 2-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethylamino]-5-phenylmethoxy-1H-pyrimidin-6-one.
| Compound Name | 2-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethylamino]-5-phenylmethoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 12951577 |
| Molecular Formula | C17H18BrN5O2S |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 2-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethylamino]-5-phenylmethoxy-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(NCCSCc2[nH]cnc2Br)ncc1OCc1ccccc1 |
| InChI | InChI=1S/C17H18BrN5O2S/c18-15-13(21-11-22-15)10-26-7-6-19-17-20-8-14(16(24)23-17)25-9-12-4-2-1-3-5-12/h1-5,8,11H,6-7,9-10H2,(H,21,22)(H2,19,20,23,24) |
| InChIKey | QCRYTAREHNAPCO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|