C17H18N4O2S2 — CID 12951614
5-phenylmethoxy-2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethylamino]-1H-pyrimidin-6-one (PubChem CID 12951614) has the molecular formula C17H18N4O2S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-phenylmethoxy-2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-phenylmethoxy-2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 12951614 |
| Molecular Formula | C17H18N4O2S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 5-phenylmethoxy-2-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethylamino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(NCCSCc2nccs2)ncc1OCc1ccccc1 |
| InChI | InChI=1S/C17H18N4O2S2/c22-16-14(23-11-13-4-2-1-3-5-13)10-20-17(21-16)19-6-8-24-12-15-18-7-9-25-15/h1-5,7,9-10H,6,8,11-12H2,(H2,19,20,21,22) |
| InChIKey | VVBPAJAANJLPQR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|