C15H18BrIN4OS2 — CID 20508641
[benzamido(methylsulfanyl)methylidene]-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethyl]azanium iodide (PubChem CID 20508641) has the molecular formula C15H18BrIN4OS2 and a molecular weight of 541.28 g/mol. Its IUPAC name is [benzamido(methylsulfanyl)methylidene]-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethyl]azanium iodide.
| Compound Name | [benzamido(methylsulfanyl)methylidene]-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethyl]azanium iodide |
|---|---|
| PubChem CID | 20508641 |
| Molecular Formula | C15H18BrIN4OS2 |
| Molecular Weight | 541.28 g/mol |
| Exact Mass | 539.92 |
| IUPAC Name | [benzamido(methylsulfanyl)methylidene]-[2-[(4-bromo-1H-imidazol-5-yl)methylsulfanyl]ethyl]azanium iodide |
| SMILES | CS/C(NC(=O)c1ccccc1)=[NH+]\CCSCc1[nH]cnc1Br.[I-] |
| InChI | InChI=1S/C15H17BrN4OS2.HI/c1-22-15(20-14(21)11-5-3-2-4-6-11)17-7-8-23-9-12-13(16)19-10-18-12;/h2-6,10H,7-9H2,1H3,(H,18,19)(H,17,20,21);1H |
| InChIKey | TZKOFFJXOMOWTQ-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.28 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|