C19H20ClN5O2S2 — CID 135987451
2-(4-chlorophenyl)sulfonyl-2-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-N-prop-2-ynylethanimidamide (PubChem CID 135987451) has the molecular formula C19H20ClN5O2S2 and a molecular weight of 449.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-2-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-N-prop-2-ynylethanimidamide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-2-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-N-prop-2-ynylethanimidamide |
|---|---|
| PubChem CID | 135987451 |
| Molecular Formula | C19H20ClN5O2S2 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-2-cyano-N'-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-N-prop-2-ynylethanimidamide |
| SMILES | C#CCN/C(=N\CCSCc1nc[nH]c1C)C(C#N)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClN5O2S2/c1-3-8-22-19(23-9-10-28-12-17-14(2)24-13-25-17)18(11-21)29(26,27)16-6-4-15(20)5-7-16/h1,4-7,13,18H,8-10,12H2,2H3,(H,22,23)(H,24,25) |
| InChIKey | VANHWMOAQAOWQG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|