C20H23N5O2S2 — CID 23342743
(Z)-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-2-(4-methylphenyl)sulfonyl-3-(prop-2-ynylamino)prop-2-enenitrile (PubChem CID 23342743) has the molecular formula C20H23N5O2S2 and a molecular weight of 429.57 g/mol. Its IUPAC name is (Z)-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-2-(4-methylphenyl)sulfonyl-3-(prop-2-ynylamino)prop-2-enenitrile.
| Compound Name | (Z)-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-2-(4-methylphenyl)sulfonyl-3-(prop-2-ynylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 23342743 |
| Molecular Formula | C20H23N5O2S2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (Z)-3-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-2-(4-methylphenyl)sulfonyl-3-(prop-2-ynylamino)prop-2-enenitrile |
| SMILES | C#CCN/C(NCCSCc1nc[nH]c1C)=C(\C#N)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H23N5O2S2/c1-4-9-22-20(23-10-11-28-13-18-16(3)24-14-25-18)19(12-21)29(26,27)17-7-5-15(2)6-8-17/h1,5-8,14,22-23H,9-11,13H2,2-3H3,(H,24,25)/b20-19- |
| InChIKey | DPCLKMVJBRICAV-VXPUYCOJSA-N |
| XLogP | 2.24 |
| TPSA | 110.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|