C15H24N4O2S2 — CID 12926518
(E)-1-N-methyl-2-nitro-1-N'-[2-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]ethene-1,1-diamine (PubChem CID 12926518) has the molecular formula C15H24N4O2S2 and a molecular weight of 356.52 g/mol. Its IUPAC name is (E)-1-N-methyl-2-nitro-1-N'-[2-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]ethene-1,1-diamine.
| Compound Name | (E)-1-N-methyl-2-nitro-1-N'-[2-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 12926518 |
| Molecular Formula | C15H24N4O2S2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (E)-1-N-methyl-2-nitro-1-N'-[2-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]ethene-1,1-diamine |
| SMILES | CN/C(=C\[N+](=O)[O-])NCCSCc1cc(CN2CCCC2)cs1 |
| InChI | InChI=1S/C15H24N4O2S2/c1-16-15(10-19(20)21)17-4-7-22-12-14-8-13(11-23-14)9-18-5-2-3-6-18/h8,10-11,16-17H,2-7,9,12H2,1H3/b15-10+ |
| InChIKey | LAIWLFODIFXZPL-XNTDXEJSSA-N |
| XLogP | 2.46 |
| TPSA | 70.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|