C13H23N5O3S2 — CID 54525566
N-(2-hydroxyethyl)-N'-[3-[[2-(methylaminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]propyl]-2-nitroethanimidamide (PubChem CID 54525566) has the molecular formula C13H23N5O3S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N'-[3-[[2-(methylaminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]propyl]-2-nitroethanimidamide.
| Compound Name | N-(2-hydroxyethyl)-N'-[3-[[2-(methylaminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]propyl]-2-nitroethanimidamide |
|---|---|
| PubChem CID | 54525566 |
| Molecular Formula | C13H23N5O3S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-(2-hydroxyethyl)-N'-[3-[[2-(methylaminomethyl)-1,3-thiazol-4-yl]methylsulfanyl]propyl]-2-nitroethanimidamide |
| SMILES | CNCc1nc(CSCCC/N=C(\C[N+](=O)[O-])NCCO)cs1 |
| InChI | InChI=1S/C13H23N5O3S2/c1-14-7-13-17-11(10-23-13)9-22-6-2-3-15-12(8-18(20)21)16-4-5-19/h10,14,19H,2-9H2,1H3,(H,15,16) |
| InChIKey | YSWIUGUOUGXGCB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|