About N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide
N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide (PubChem CID 137289293) has the molecular formula C8H17N9O4
and a molecular weight of 303.28 g/mol. Its IUPAC name is N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide.
Molecular Properties
| Compound Name | N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide |
| PubChem CID | 137289293 |
| Molecular Formula | C8H17N9O4 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide |
| SMILES | N/C(=N\[N+](=O)[O-])NCCN1CCN(N/C=N/[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C8H17N9O4/c9-8(13-17(20)21)10-1-2-14-3-5-15(6-4-14)11-7-12-16(18)19/h7H,1-6H2,(H,11,12)(H3,9,10,13) |
| InChIKey | AKJWZLZULQINCM-UHFFFAOYSA-N |
| XLogP | -2.58 |
| TPSA | 167.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide?
The IUPAC name of N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide (CID 137289293) is N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide.
What is the SMILES notation for N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide?
The canonical SMILES for N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide is N/C(=N\[N+](=O)[O-])NCCN1CCN(N/C=N/[N+](=O)[O-])CC1.
What is the InChIKey of N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide?
The InChIKey is AKJWZLZULQINCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N9O4/c9-8(13-17(20)21)10-1-2-14-3-5-15(6-4-14)11-7-12-16(18)19/h7H,1-6H2,(H,11,12)(H3,9,10,13).
What are the key properties of N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide?
N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide has a molecular weight of 303.28 g/mol, XLogP of -2.58, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-nitro-N-[4-[2-[[(E)-N'-nitrocarbamimidoyl]amino]ethyl]piperazin-1-yl]methanimidamide is sourced from PubChem (CID 137289293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).