C11H24F3N7O4 — CID 135440035
1-[(4S)-4-amino-5-(3-aminopropylamino)pentyl]-2-nitroguanidine;2,2,2-trifluoroacetic acid (PubChem CID 135440035) has the molecular formula C11H24F3N7O4 and a molecular weight of 375.35 g/mol. Its IUPAC name is 1-[(4S)-4-amino-5-(3-aminopropylamino)pentyl]-2-nitroguanidine;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(4S)-4-amino-5-(3-aminopropylamino)pentyl]-2-nitroguanidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 135440035 |
| Molecular Formula | C11H24F3N7O4 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-[(4S)-4-amino-5-(3-aminopropylamino)pentyl]-2-nitroguanidine;2,2,2-trifluoroacetic acid |
| SMILES | NCCCNC[C@@H](N)CCCN/C(N)=N\[N+](=O)[O-].O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H23N7O2.C2HF3O2/c10-4-2-5-13-7-8(11)3-1-6-14-9(12)15-16(17)18;3-2(4,5)1(6)7/h8,13H,1-7,10-11H2,(H3,12,14,15);(H,6,7)/t8-;/m0./s1 |
| InChIKey | QGVHWTWGMYNZHY-QRPNPIFTSA-N |
| XLogP | -1.24 |
| TPSA | 194.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|