C13H23N7O2 — CID 173152645
1-[(4S)-4-amino-5-[(4-aminophenyl)methylamino]pentyl]-2-nitroguanidine (PubChem CID 173152645) has the molecular formula C13H23N7O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-[(4S)-4-amino-5-[(4-aminophenyl)methylamino]pentyl]-2-nitroguanidine.
| Compound Name | 1-[(4S)-4-amino-5-[(4-aminophenyl)methylamino]pentyl]-2-nitroguanidine |
|---|---|
| PubChem CID | 173152645 |
| Molecular Formula | C13H23N7O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-[(4S)-4-amino-5-[(4-aminophenyl)methylamino]pentyl]-2-nitroguanidine |
| SMILES | NC(=N[N+](=O)[O-])NCCC[C@H](N)CNCc1ccc(N)cc1 |
| InChI | InChI=1S/C13H23N7O2/c14-11-5-3-10(4-6-11)8-17-9-12(15)2-1-7-18-13(16)19-20(21)22/h3-6,12,17H,1-2,7-9,14-15H2,(H3,16,18,19)/t12-/m0/s1 |
| InChIKey | ARDHMGLGQQTAQP-LBPRGKRZSA-N |
| XLogP | -0.44 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|