C19H31N6O6+ — CID 135984158
(R)-[1-amino-5-[(N'-nitrocarbamimidoyl)amino]-1-oxopentan-2-yl]-[(4-hydroxyphenyl)methyl]-methyl-[(2-methylpropan-2-yl)oxycarbonyl]azanium (PubChem CID 135984158) has the molecular formula C19H31N6O6+ and a molecular weight of 439.49 g/mol. Its IUPAC name is (R)-[1-amino-5-[(N'-nitrocarbamimidoyl)amino]-1-oxopentan-2-yl]-[(4-hydroxyphenyl)methyl]-methyl-[(2-methylpropan-2-yl)oxycarbonyl]azanium.
| Compound Name | (R)-[1-amino-5-[(N'-nitrocarbamimidoyl)amino]-1-oxopentan-2-yl]-[(4-hydroxyphenyl)methyl]-methyl-[(2-methylpropan-2-yl)oxycarbonyl]azanium |
|---|---|
| PubChem CID | 135984158 |
| Molecular Formula | C19H31N6O6+ |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | (R)-[1-amino-5-[(N'-nitrocarbamimidoyl)amino]-1-oxopentan-2-yl]-[(4-hydroxyphenyl)methyl]-methyl-[(2-methylpropan-2-yl)oxycarbonyl]azanium |
| SMILES | CC(C)(C)OC(=O)[N@+](C)(Cc1ccc(O)cc1)C(CCCNC(N)=N[N+](=O)[O-])C(N)=O |
| InChI | InChI=1S/C19H30N6O6/c1-19(2,3)31-18(28)25(4,12-13-7-9-14(26)10-8-13)15(16(20)27)6-5-11-22-17(21)23-24(29)30/h7-10,15H,5-6,11-12H2,1-4H3,(H5-,20,21,22,23,26,27)/p+1/t15?,25-/m1/s1 |
| InChIKey | IUINPFYDPLRGAZ-FFMAFDDDSA-O |
| XLogP | 1.00 |
| TPSA | 183.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|