C13H24N6O2 — CID 89221233
2-[(4S)-4-amino-5-(benzylamino)pentyl]-1-(dihydroxyamino)guanidine (PubChem CID 89221233) has the molecular formula C13H24N6O2 and a molecular weight of 296.38 g/mol. Its IUPAC name is 2-[(4S)-4-amino-5-(benzylamino)pentyl]-1-(dihydroxyamino)guanidine.
| Compound Name | 2-[(4S)-4-amino-5-(benzylamino)pentyl]-1-(dihydroxyamino)guanidine |
|---|---|
| PubChem CID | 89221233 |
| Molecular Formula | C13H24N6O2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-[(4S)-4-amino-5-(benzylamino)pentyl]-1-(dihydroxyamino)guanidine |
| SMILES | N/C(=N\CCC[C@H](N)CNCc1ccccc1)NN(O)O |
| InChI | InChI=1S/C13H24N6O2/c14-12(7-4-8-17-13(15)18-19(20)21)10-16-9-11-5-2-1-3-6-11/h1-3,5-6,12,16,20-21H,4,7-10,14H2,(H3,15,17,18)/t12-/m0/s1 |
| InChIKey | WBADPFGOMVHBNC-LBPRGKRZSA-N |
| XLogP | -0.22 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|