C16H21N3 — CID 115119687
3-N-[(4-phenylphenyl)methyl]propane-1,2,3-triamine (PubChem CID 115119687) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 3-N-[(4-phenylphenyl)methyl]propane-1,2,3-triamine.
| Compound Name | 3-N-[(4-phenylphenyl)methyl]propane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119687 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 3-N-[(4-phenylphenyl)methyl]propane-1,2,3-triamine |
| SMILES | NCC(N)CNCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H21N3/c17-10-16(18)12-19-11-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-9,16,19H,10-12,17-18H2 |
| InChIKey | AMWUMOAGUMPLQI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |