C13H23N3 — CID 115119666
3-N-[(4-propylphenyl)methyl]propane-1,2,3-triamine (PubChem CID 115119666) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 3-N-[(4-propylphenyl)methyl]propane-1,2,3-triamine.
| Compound Name | 3-N-[(4-propylphenyl)methyl]propane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119666 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 3-N-[(4-propylphenyl)methyl]propane-1,2,3-triamine |
| SMILES | CCCc1ccc(CNCC(N)CN)cc1 |
| InChI | InChI=1S/C13H23N3/c1-2-3-11-4-6-12(7-5-11)9-16-10-13(15)8-14/h4-7,13,16H,2-3,8-10,14-15H2,1H3 |
| InChIKey | YZYZGNYTWJBACX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |