C13H21FN2 — CID 83960594
1-N-[(4-fluorophenyl)methyl]hexane-1,2-diamine (PubChem CID 83960594) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is 1-N-[(4-fluorophenyl)methyl]hexane-1,2-diamine.
| Compound Name | 1-N-[(4-fluorophenyl)methyl]hexane-1,2-diamine |
|---|---|
| PubChem CID | 83960594 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 1-N-[(4-fluorophenyl)methyl]hexane-1,2-diamine |
| SMILES | CCCCC(N)CNCc1ccc(F)cc1 |
| InChI | InChI=1S/C13H21FN2/c1-2-3-4-13(15)10-16-9-11-5-7-12(14)8-6-11/h5-8,13,16H,2-4,9-10,15H2,1H3 |
| InChIKey | COKOAUPIHZUDLD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |