C15H27N3 — CID 115119935
3-N-[2-(4-tert-butylphenyl)ethyl]propane-1,2,3-triamine (PubChem CID 115119935) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 3-N-[2-(4-tert-butylphenyl)ethyl]propane-1,2,3-triamine.
| Compound Name | 3-N-[2-(4-tert-butylphenyl)ethyl]propane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119935 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 3-N-[2-(4-tert-butylphenyl)ethyl]propane-1,2,3-triamine |
| SMILES | CC(C)(C)c1ccc(CCNCC(N)CN)cc1 |
| InChI | InChI=1S/C15H27N3/c1-15(2,3)13-6-4-12(5-7-13)8-9-18-11-14(17)10-16/h4-7,14,18H,8-11,16-17H2,1-3H3 |
| InChIKey | MHXORBQFPMADLL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|