C8H16F3N3O3 — CID 87130105
1-(3-aminopropyl)-3-ethylurea;2,2,2-trifluoroacetic acid (PubChem CID 87130105) has the molecular formula C8H16F3N3O3 and a molecular weight of 259.23 g/mol. Its IUPAC name is 1-(3-aminopropyl)-3-ethylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(3-aminopropyl)-3-ethylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87130105 |
| Molecular Formula | C8H16F3N3O3 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-(3-aminopropyl)-3-ethylurea;2,2,2-trifluoroacetic acid |
| SMILES | CCNC(=O)NCCCN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C6H15N3O.C2HF3O2/c1-2-8-6(10)9-5-3-4-7;3-2(4,5)1(6)7/h2-5,7H2,1H3,(H2,8,9,10);(H,6,7) |
| InChIKey | DFNPBSZDPZUHPJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|