C11H20F3IN2O3 — CID 164577522
N-(7-aminoheptyl)-2-iodoacetamide;2,2,2-trifluoroacetic acid (PubChem CID 164577522) has the molecular formula C11H20F3IN2O3 and a molecular weight of 412.19 g/mol. Its IUPAC name is N-(7-aminoheptyl)-2-iodoacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-(7-aminoheptyl)-2-iodoacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 164577522 |
| Molecular Formula | C11H20F3IN2O3 |
| Molecular Weight | 412.19 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | N-(7-aminoheptyl)-2-iodoacetamide;2,2,2-trifluoroacetic acid |
| SMILES | NCCCCCCCNC(=O)CI.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H19IN2O.C2HF3O2/c10-8-9(13)12-7-5-3-1-2-4-6-11;3-2(4,5)1(6)7/h1-8,11H2,(H,12,13);(H,6,7) |
| InChIKey | RQWCBPJHUXACBB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|