About CID 89207186
CID 89207186 (PubChem CID 89207186) has the molecular formula C8H17BN2O
and a molecular weight of 168.05 g/mol.
Molecular Properties
| Compound Name | CID 89207186 |
| PubChem CID | 89207186 |
| Molecular Formula | C8H17BN2O |
| Molecular Weight | 168.05 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)NCCCCCCN |
| InChI | InChI=1S/C8H17BN2O/c9-7-8(12)11-6-4-2-1-3-5-10/h1-7,10H2,(H,11,12) |
| InChIKey | BXVPWEPIARAEAP-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.05 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89207186 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89207186?
The IUPAC name of CID 89207186 (CID 89207186) is not available.
What is the SMILES notation for CID 89207186?
The canonical SMILES for CID 89207186 is [B]CC(=O)NCCCCCCN.
What is the InChIKey of CID 89207186?
The InChIKey is BXVPWEPIARAEAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17BN2O/c9-7-8(12)11-6-4-2-1-3-5-10/h1-7,10H2,(H,11,12).
What are the key properties of CID 89207186?
CID 89207186 has a molecular weight of 168.05 g/mol, XLogP of 0.21, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89207186 is sourced from PubChem (CID 89207186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).