C8H17N3O2 — CID 140634457
(E)-1-N-butyl-1-N',1-N'-dimethyl-2-nitroethene-1,1-diamine (PubChem CID 140634457) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is (E)-1-N-butyl-1-N',1-N'-dimethyl-2-nitroethene-1,1-diamine.
| Compound Name | (E)-1-N-butyl-1-N',1-N'-dimethyl-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 140634457 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | (E)-1-N-butyl-1-N',1-N'-dimethyl-2-nitroethene-1,1-diamine |
| SMILES | CCCCN/C(=C\[N+](=O)[O-])N(C)C |
| InChI | InChI=1S/C8H17N3O2/c1-4-5-6-9-8(10(2)3)7-11(12)13/h7,9H,4-6H2,1-3H3/b8-7+ |
| InChIKey | BBKDSVISZFTLCM-BQYQJAHWSA-N |
| XLogP | 1.01 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|