C9H19N3O2 — CID 59463868
(E)-1-N'-(4,4-dimethylpentyl)-2-nitroethene-1,1-diamine (PubChem CID 59463868) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is (E)-1-N'-(4,4-dimethylpentyl)-2-nitroethene-1,1-diamine.
| Compound Name | (E)-1-N'-(4,4-dimethylpentyl)-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 59463868 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (E)-1-N'-(4,4-dimethylpentyl)-2-nitroethene-1,1-diamine |
| SMILES | CC(C)(C)CCCN/C(N)=C/[N+](=O)[O-] |
| InChI | InChI=1S/C9H19N3O2/c1-9(2,3)5-4-6-11-8(10)7-12(13)14/h7,11H,4-6,10H2,1-3H3/b8-7+ |
| InChIKey | NJBUVGURRZWTCD-BQYQJAHWSA-N |
| XLogP | 1.44 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|