C6H10INO2 — CID 134875400
(E)-2-iodo-3,3-dimethyl-1-nitrobut-1-ene (PubChem CID 134875400) has the molecular formula C6H10INO2 and a molecular weight of 255.05 g/mol. Its IUPAC name is (E)-2-iodo-3,3-dimethyl-1-nitrobut-1-ene.
| Compound Name | (E)-2-iodo-3,3-dimethyl-1-nitrobut-1-ene |
|---|---|
| PubChem CID | 134875400 |
| Molecular Formula | C6H10INO2 |
| Molecular Weight | 255.05 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | (E)-2-iodo-3,3-dimethyl-1-nitrobut-1-ene |
| SMILES | CC(C)(C)/C(I)=C\[N+](=O)[O-] |
| InChI | InChI=1S/C6H10INO2/c1-6(2,3)5(7)4-8(9)10/h4H,1-3H3/b5-4+ |
| InChIKey | PCDCROBOEYWMNM-SNAWJCMRSA-N |
| XLogP | 2.59 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.05 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|