C6H8N2O4 — CID 71423642
2,3-dimethyl-1,4-dinitrobuta-1,3-diene (PubChem CID 71423642) has the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-dinitrobuta-1,3-diene.
| Compound Name | 2,3-dimethyl-1,4-dinitrobuta-1,3-diene |
|---|---|
| PubChem CID | 71423642 |
| Molecular Formula | C6H8N2O4 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 2,3-dimethyl-1,4-dinitrobuta-1,3-diene |
| SMILES | CC(=C[N+](=O)[O-])C(C)=C[N+](=O)[O-] |
| InChI | InChI=1S/C6H8N2O4/c1-5(3-7(9)10)6(2)4-8(11)12/h3-4H,1-2H3 |
| InChIKey | GGDHTSMOXMEUSL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|