About bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+)
bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+) (PubChem CID 4223018) has the molecular formula C4H10N2O4PtS4+6
and a molecular weight of 473.48 g/mol. Its IUPAC name is bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+).
Molecular Properties
| Compound Name | bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+) |
| PubChem CID | 4223018 |
| Molecular Formula | C4H10N2O4PtS4+6 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 472.91 |
| IUPAC Name | bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+) |
| SMILES | O=[N+]([O-])C=C([SH2+])[SH2+].O=[N+]([O-])C=C([SH2+])[SH2+].[Pt+2] |
| InChI | InChI=1S/2C2H3NO2S2.Pt/c2*4-3(5)1-2(6)7;/h2*1,6-7H;/q;;+2/p+4 |
| InChIKey | OYPKPOIILPZCFC-UHFFFAOYSA-R |
| XLogP | -1.83 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+)?
The IUPAC name of bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+) (CID 4223018) is bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+).
What is the SMILES notation for bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+)?
The canonical SMILES for bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+) is O=[N+]([O-])C=C([SH2+])[SH2+].O=[N+]([O-])C=C([SH2+])[SH2+].[Pt+2].
What is the InChIKey of bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+)?
The InChIKey is OYPKPOIILPZCFC-UHFFFAOYSA-R. The full InChI is InChI=1S/2C2H3NO2S2.Pt/c2*4-3(5)1-2(6)7;/h2*1,6-7H;/q;;+2/p+4.
What are the key properties of bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+)?
bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+) has a molecular weight of 473.48 g/mol, XLogP of -1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis((2-nitro-1-sulfaniumylethenyl)sulfanium);platinum(2+) is sourced from PubChem (CID 4223018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).