About dipotassium;2-nitroethene-1,1-dithiol
dipotassium;2-nitroethene-1,1-dithiol (PubChem CID 136799546) has the molecular formula C2H3K2NO2S2+2
and a molecular weight of 215.38 g/mol. Its IUPAC name is dipotassium;2-nitroethene-1,1-dithiol.
Molecular Properties
| Compound Name | dipotassium;2-nitroethene-1,1-dithiol |
| PubChem CID | 136799546 |
| Molecular Formula | C2H3K2NO2S2+2 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 214.89 |
| IUPAC Name | dipotassium;2-nitroethene-1,1-dithiol |
| SMILES | O=[N+]([O-])C=C(S)S.[K+].[K+] |
| InChI | InChI=1S/C2H3NO2S2.2K/c4-3(5)1-2(6)7;;/h1,6-7H;;/q;2*+1 |
| InChIKey | NLOLYGOJQHBROF-UHFFFAOYSA-N |
| XLogP | -5.07 |
| TPSA | 43.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | -5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;2-nitroethene-1,1-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-nitroethene-1,1-dithiol?
The IUPAC name of dipotassium;2-nitroethene-1,1-dithiol (CID 136799546) is dipotassium;2-nitroethene-1,1-dithiol.
What is the SMILES notation for dipotassium;2-nitroethene-1,1-dithiol?
The canonical SMILES for dipotassium;2-nitroethene-1,1-dithiol is O=[N+]([O-])C=C(S)S.[K+].[K+].
What is the InChIKey of dipotassium;2-nitroethene-1,1-dithiol?
The InChIKey is NLOLYGOJQHBROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3NO2S2.2K/c4-3(5)1-2(6)7;;/h1,6-7H;;/q;2*+1.
What are the key properties of dipotassium;2-nitroethene-1,1-dithiol?
dipotassium;2-nitroethene-1,1-dithiol has a molecular weight of 215.38 g/mol, XLogP of -5.07, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-nitroethene-1,1-dithiol is sourced from PubChem (CID 136799546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).