C2HKN2O6 — CID 23331485
potassium 2,2-dinitroacetate (PubChem CID 23331485) has the molecular formula C2HKN2O6 and a molecular weight of 188.14 g/mol. Its IUPAC name is potassium 2,2-dinitroacetate.
| Compound Name | potassium 2,2-dinitroacetate |
|---|---|
| PubChem CID | 23331485 |
| Molecular Formula | C2HKN2O6 |
| Molecular Weight | 188.14 g/mol |
| Exact Mass | 187.95 |
| IUPAC Name | potassium 2,2-dinitroacetate |
| SMILES | O=C([O-])C([N+](=O)[O-])[N+](=O)[O-].[K+] |
| InChI | InChI=1S/C2H2N2O6.K/c5-2(6)1(3(7)8)4(9)10;/h1H,(H,5,6);/q;+1/p-1 |
| InChIKey | XSTDPOQBUQUNER-UHFFFAOYSA-M |
| XLogP | -5.38 |
| TPSA | 126.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.14 |
| LogP ≤ 5 | -5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|