C9H17N3O2 — CID 134923419
(3E)-1-N,1-N,1-N',1-N',3-pentamethyl-4-nitrobuta-1,3-diene-1,1-diamine (PubChem CID 134923419) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is (3E)-1-N,1-N,1-N',1-N',3-pentamethyl-4-nitrobuta-1,3-diene-1,1-diamine.
| Compound Name | (3E)-1-N,1-N,1-N',1-N',3-pentamethyl-4-nitrobuta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 134923419 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | (3E)-1-N,1-N,1-N',1-N',3-pentamethyl-4-nitrobuta-1,3-diene-1,1-diamine |
| SMILES | C/C(C=C(N(C)C)N(C)C)=C\[N+](=O)[O-] |
| InChI | InChI=1S/C9H17N3O2/c1-8(7-12(13)14)6-9(10(2)3)11(4)5/h6-7H,1-5H3/b8-7+ |
| InChIKey | WHQOFUDXWLRRFU-BQYQJAHWSA-N |
| XLogP | 1.13 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|