C10H17N3 — CID 134987813
(2E)-5,5-bis(dimethylamino)-3-methylpenta-2,4-dienenitrile (PubChem CID 134987813) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is (2E)-5,5-bis(dimethylamino)-3-methylpenta-2,4-dienenitrile.
| Compound Name | (2E)-5,5-bis(dimethylamino)-3-methylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 134987813 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (2E)-5,5-bis(dimethylamino)-3-methylpenta-2,4-dienenitrile |
| SMILES | C/C(C=C(N(C)C)N(C)C)=C\C#N |
| InChI | InChI=1S/C10H17N3/c1-9(6-7-11)8-10(12(2)3)13(4)5/h6,8H,1-5H3/b9-6+ |
| InChIKey | ZTMKWRRYHMXHJI-RMKNXTFCSA-N |
| XLogP | 1.42 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|