About dimethylcarbamodithioic acid;prop-2-enenitrile
dimethylcarbamodithioic acid;prop-2-enenitrile (PubChem CID 175475389) has the molecular formula C6H10N2S2
and a molecular weight of 174.29 g/mol. Its IUPAC name is dimethylcarbamodithioic acid;prop-2-enenitrile.
Molecular Properties
| Compound Name | dimethylcarbamodithioic acid;prop-2-enenitrile |
| PubChem CID | 175475389 |
| Molecular Formula | C6H10N2S2 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | dimethylcarbamodithioic acid;prop-2-enenitrile |
| SMILES | C=CC#N.CN(C)C(=S)S |
| InChI | InChI=1S/C3H7NS2.C3H3N/c1-4(2)3(5)6;1-2-3-4/h1-2H3,(H,5,6);2H,1H2 |
| InChIKey | LDOZDKPTNRIPIL-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 27.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dimethylcarbamodithioic acid;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylcarbamodithioic acid;prop-2-enenitrile?
The IUPAC name of dimethylcarbamodithioic acid;prop-2-enenitrile (CID 175475389) is dimethylcarbamodithioic acid;prop-2-enenitrile.
What is the SMILES notation for dimethylcarbamodithioic acid;prop-2-enenitrile?
The canonical SMILES for dimethylcarbamodithioic acid;prop-2-enenitrile is C=CC#N.CN(C)C(=S)S.
What is the InChIKey of dimethylcarbamodithioic acid;prop-2-enenitrile?
The InChIKey is LDOZDKPTNRIPIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NS2.C3H3N/c1-4(2)3(5)6;1-2-3-4/h1-2H3,(H,5,6);2H,1H2.
What are the key properties of dimethylcarbamodithioic acid;prop-2-enenitrile?
dimethylcarbamodithioic acid;prop-2-enenitrile has a molecular weight of 174.29 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylcarbamodithioic acid;prop-2-enenitrile is sourced from PubChem (CID 175475389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).